C19H26OS — CID 15504179
1-[(1S,2S)-2-methoxy-2-[(2E)-penta-2,4-dienyl]cyclohexyl]sulfanyl-4-methylbenzene (PubChem CID 15504179) has the molecular formula C19H26OS and a molecular weight of 302.48 g/mol. Its IUPAC name is 1-[(1S,2S)-2-methoxy-2-[(2E)-penta-2,4-dienyl]cyclohexyl]sulfanyl-4-methylbenzene.
| Compound Name | 1-[(1S,2S)-2-methoxy-2-[(2E)-penta-2,4-dienyl]cyclohexyl]sulfanyl-4-methylbenzene |
|---|---|
| PubChem CID | 15504179 |
| Molecular Formula | C19H26OS |
| Molecular Weight | 302.48 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 1-[(1S,2S)-2-methoxy-2-[(2E)-penta-2,4-dienyl]cyclohexyl]sulfanyl-4-methylbenzene |
| SMILES | C=C/C=C/C[C@@]1(OC)CCCC[C@@H]1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C19H26OS/c1-4-5-7-14-19(20-3)15-8-6-9-18(19)21-17-12-10-16(2)11-13-17/h4-5,7,10-13,18H,1,6,8-9,14-15H2,2-3H3/b7-5+/t18-,19+/m0/s1 |
| InChIKey | MIXJWSZEOZGFKR-VUTZTEFLSA-N |
| XLogP | 5.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.48 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|