C9H7BrClN3S — CID 155042082
2-(3-bromo-5-methylsulfanylpyrazol-1-yl)-3-chloropyridine (PubChem CID 155042082) has the molecular formula C9H7BrClN3S and a molecular weight of 304.60 g/mol. Its IUPAC name is 2-(3-bromo-5-methylsulfanylpyrazol-1-yl)-3-chloropyridine.
| Compound Name | 2-(3-bromo-5-methylsulfanylpyrazol-1-yl)-3-chloropyridine |
|---|---|
| PubChem CID | 155042082 |
| Molecular Formula | C9H7BrClN3S |
| Molecular Weight | 304.60 g/mol |
| Exact Mass | 302.92 |
| IUPAC Name | 2-(3-bromo-5-methylsulfanylpyrazol-1-yl)-3-chloropyridine |
| SMILES | CSc1cc(Br)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C9H7BrClN3S/c1-15-8-5-7(10)13-14(8)9-6(11)3-2-4-12-9/h2-5H,1H3 |
| InChIKey | HRLINKCIGJPELW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.60 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |