C36H36O4 — CID 155043172
2-[(3E,5E)-1-(4-butylphenyl)-3-hydroxy-6-(4-hydroxyphenyl)-2-methylidenehepta-3,5-dienyl]-4-(4-hydroxyphenyl)phenol (PubChem CID 155043172) has the molecular formula C36H36O4 and a molecular weight of 532.68 g/mol. Its IUPAC name is 2-[(3E,5E)-1-(4-butylphenyl)-3-hydroxy-6-(4-hydroxyphenyl)-2-methylidenehepta-3,5-dienyl]-4-(4-hydroxyphenyl)phenol.
| Compound Name | 2-[(3E,5E)-1-(4-butylphenyl)-3-hydroxy-6-(4-hydroxyphenyl)-2-methylidenehepta-3,5-dienyl]-4-(4-hydroxyphenyl)phenol |
|---|---|
| PubChem CID | 155043172 |
| Molecular Formula | C36H36O4 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 2-[(3E,5E)-1-(4-butylphenyl)-3-hydroxy-6-(4-hydroxyphenyl)-2-methylidenehepta-3,5-dienyl]-4-(4-hydroxyphenyl)phenol |
| SMILES | C=C(/C(O)=C\C=C(/C)c1ccc(O)cc1)C(c1ccc(CCCC)cc1)c1cc(-c2ccc(O)cc2)ccc1O |
| InChI | InChI=1S/C36H36O4/c1-4-5-6-26-8-10-29(11-9-26)36(25(3)34(39)21-7-24(2)27-12-17-31(37)18-13-27)33-23-30(16-22-35(33)40)28-14-19-32(38)20-15-28/h7-23,36-40H,3-6H2,1-2H3/b24-7+,34-21+ |
| InChIKey | BUUPUJGTUOGLIQ-OCSPACHLSA-N |
| XLogP | 9.05 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|