About (4E,5E)-4-ethylidene-5-(3-methylbutylidene)-1,3-thiazole
(4E,5E)-4-ethylidene-5-(3-methylbutylidene)-1,3-thiazole (PubChem CID 155044425) has the molecular formula C10H15NS
and a molecular weight of 181.30 g/mol. Its IUPAC name is (4E,5E)-4-ethylidene-5-(3-methylbutylidene)-1,3-thiazole.
Molecular Properties
| Compound Name | (4E,5E)-4-ethylidene-5-(3-methylbutylidene)-1,3-thiazole |
| PubChem CID | 155044425 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (4E,5E)-4-ethylidene-5-(3-methylbutylidene)-1,3-thiazole |
| SMILES | C/C=c1/ncs/c1=C/CC(C)C |
| InChI | InChI=1S/C10H15NS/c1-4-9-10(12-7-11-9)6-5-8(2)3/h4,6-8H,5H2,1-3H3/b9-4+,10-6+ |
| InChIKey | PBLVZQGHXFWQFT-IPHTWBMMSA-N |
| XLogP | 1.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4E,5E)-4-ethylidene-5-(3-methylbutylidene)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-4-ethylidene-5-(3-methylbutylidene)-1,3-thiazole?
The IUPAC name of (4E,5E)-4-ethylidene-5-(3-methylbutylidene)-1,3-thiazole (CID 155044425) is (4E,5E)-4-ethylidene-5-(3-methylbutylidene)-1,3-thiazole.
What is the SMILES notation for (4E,5E)-4-ethylidene-5-(3-methylbutylidene)-1,3-thiazole?
The canonical SMILES for (4E,5E)-4-ethylidene-5-(3-methylbutylidene)-1,3-thiazole is C/C=c1/ncs/c1=C/CC(C)C.
What is the InChIKey of (4E,5E)-4-ethylidene-5-(3-methylbutylidene)-1,3-thiazole?
The InChIKey is PBLVZQGHXFWQFT-IPHTWBMMSA-N. The full InChI is InChI=1S/C10H15NS/c1-4-9-10(12-7-11-9)6-5-8(2)3/h4,6-8H,5H2,1-3H3/b9-4+,10-6+.
What are the key properties of (4E,5E)-4-ethylidene-5-(3-methylbutylidene)-1,3-thiazole?
(4E,5E)-4-ethylidene-5-(3-methylbutylidene)-1,3-thiazole has a molecular weight of 181.30 g/mol, XLogP of 1.77, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-4-ethylidene-5-(3-methylbutylidene)-1,3-thiazole is sourced from PubChem (CID 155044425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).