About 4-[(3Z)-penta-1,3-dien-2-yl]-2H-2,7-naphthyridin-1-one
4-[(3Z)-penta-1,3-dien-2-yl]-2H-2,7-naphthyridin-1-one (PubChem CID 155044833) has the molecular formula C13H12N2O
and a molecular weight of 212.25 g/mol. Its IUPAC name is 4-[(3Z)-penta-1,3-dien-2-yl]-2H-2,7-naphthyridin-1-one.
Molecular Properties
| Compound Name | 4-[(3Z)-penta-1,3-dien-2-yl]-2H-2,7-naphthyridin-1-one |
| PubChem CID | 155044833 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 4-[(3Z)-penta-1,3-dien-2-yl]-2H-2,7-naphthyridin-1-one |
| SMILES | C=C(/C=C\C)c1c[nH]c(=O)c2cnccc12 |
| InChI | InChI=1S/C13H12N2O/c1-3-4-9(2)11-8-15-13(16)12-7-14-6-5-10(11)12/h3-8H,2H2,1H3,(H,15,16)/b4-3- |
| InChIKey | FYLKYFHZQSXDTF-ARJAWSKDSA-N |
| XLogP | 2.51 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3Z)-penta-1,3-dien-2-yl]-2H-2,7-naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3Z)-penta-1,3-dien-2-yl]-2H-2,7-naphthyridin-1-one?
The IUPAC name of 4-[(3Z)-penta-1,3-dien-2-yl]-2H-2,7-naphthyridin-1-one (CID 155044833) is 4-[(3Z)-penta-1,3-dien-2-yl]-2H-2,7-naphthyridin-1-one.
What is the SMILES notation for 4-[(3Z)-penta-1,3-dien-2-yl]-2H-2,7-naphthyridin-1-one?
The canonical SMILES for 4-[(3Z)-penta-1,3-dien-2-yl]-2H-2,7-naphthyridin-1-one is C=C(/C=C\C)c1c[nH]c(=O)c2cnccc12.
What is the InChIKey of 4-[(3Z)-penta-1,3-dien-2-yl]-2H-2,7-naphthyridin-1-one?
The InChIKey is FYLKYFHZQSXDTF-ARJAWSKDSA-N. The full InChI is InChI=1S/C13H12N2O/c1-3-4-9(2)11-8-15-13(16)12-7-14-6-5-10(11)12/h3-8H,2H2,1H3,(H,15,16)/b4-3-.
What are the key properties of 4-[(3Z)-penta-1,3-dien-2-yl]-2H-2,7-naphthyridin-1-one?
4-[(3Z)-penta-1,3-dien-2-yl]-2H-2,7-naphthyridin-1-one has a molecular weight of 212.25 g/mol, XLogP of 2.51, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3Z)-penta-1,3-dien-2-yl]-2H-2,7-naphthyridin-1-one is sourced from PubChem (CID 155044833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).