C21H23BrN2OS — CID 15504515
1-benzyl-2-(4-ethoxyphenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium bromide (PubChem CID 15504515) has the molecular formula C21H23BrN2OS and a molecular weight of 431.40 g/mol. Its IUPAC name is 1-benzyl-2-(4-ethoxyphenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium bromide.
| Compound Name | 1-benzyl-2-(4-ethoxyphenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium bromide |
|---|---|
| PubChem CID | 15504515 |
| Molecular Formula | C21H23BrN2OS |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 1-benzyl-2-(4-ethoxyphenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium bromide |
| SMILES | CCOc1ccc(-c2c[n+]3c(n2Cc2ccccc2)SCCC3)cc1.[Br-] |
| InChI | InChI=1S/C21H23N2OS.BrH/c1-2-24-19-11-9-18(10-12-19)20-16-22-13-6-14-25-21(22)23(20)15-17-7-4-3-5-8-17;/h3-5,7-12,16H,2,6,13-15H2,1H3;1H/q+1;/p-1 |
| InChIKey | FFQYYKCSFBOSGA-UHFFFAOYSA-M |
| XLogP | 1.39 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|