C11H13F3N3O6PS2 — CID 155046567
5-[1-(dimethoxyphosphorylmethyl)pyridin-1-ium-4-yl]-1,2,4-thiadiazole;trifluoromethanesulfonate (PubChem CID 155046567) has the molecular formula C11H13F3N3O6PS2 and a molecular weight of 435.34 g/mol. Its IUPAC name is 5-[1-(dimethoxyphosphorylmethyl)pyridin-1-ium-4-yl]-1,2,4-thiadiazole;trifluoromethanesulfonate.
| Compound Name | 5-[1-(dimethoxyphosphorylmethyl)pyridin-1-ium-4-yl]-1,2,4-thiadiazole;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 155046567 |
| Molecular Formula | C11H13F3N3O6PS2 |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 434.99 |
| IUPAC Name | 5-[1-(dimethoxyphosphorylmethyl)pyridin-1-ium-4-yl]-1,2,4-thiadiazole;trifluoromethanesulfonate |
| SMILES | COP(=O)(C[n+]1ccc(-c2ncns2)cc1)OC.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C10H13N3O3PS.CHF3O3S/c1-15-17(14,16-2)8-13-5-3-9(4-6-13)10-11-7-12-18-10;2-1(3,4)8(5,6)7/h3-7H,8H2,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | NYJVOFPRAVVBCY-UHFFFAOYSA-M |
| XLogP | 1.99 |
| TPSA | 122.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|