About [5-[1-(dimethoxyphosphorylmethyl)pyridin-1-ium-4-yl]-1,2,4-thiadiazol-3-yl] trifluoromethanesulfonate
[5-[1-(dimethoxyphosphorylmethyl)pyridin-1-ium-4-yl]-1,2,4-thiadiazol-3-yl] trifluoromethanesulfonate (PubChem CID 155046569) has the molecular formula C11H12F3N3O6PS2+
and a molecular weight of 434.33 g/mol. Its IUPAC name is [5-[1-(dimethoxyphosphorylmethyl)pyridin-1-ium-4-yl]-1,2,4-thiadiazol-3-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [5-[1-(dimethoxyphosphorylmethyl)pyridin-1-ium-4-yl]-1,2,4-thiadiazol-3-yl] trifluoromethanesulfonate |
| PubChem CID | 155046569 |
| Molecular Formula | C11H12F3N3O6PS2+ |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | [5-[1-(dimethoxyphosphorylmethyl)pyridin-1-ium-4-yl]-1,2,4-thiadiazol-3-yl] trifluoromethanesulfonate |
| SMILES | COP(=O)(C[n+]1ccc(-c2nc(OS(=O)(=O)C(F)(F)F)ns2)cc1)OC |
| InChI | InChI=1S/C11H12F3N3O6PS2/c1-21-24(18,22-2)7-17-5-3-8(4-6-17)9-15-10(16-25-9)23-26(19,20)11(12,13)14/h3-6H,7H2,1-2H3/q+1 |
| InChIKey | MOSGXYOEVGDGFS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 108.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [5-[1-(dimethoxyphosphorylmethyl)pyridin-1-ium-4-yl]-1,2,4-thiadiazol-3-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[1-(dimethoxyphosphorylmethyl)pyridin-1-ium-4-yl]-1,2,4-thiadiazol-3-yl] trifluoromethanesulfonate?
The IUPAC name of [5-[1-(dimethoxyphosphorylmethyl)pyridin-1-ium-4-yl]-1,2,4-thiadiazol-3-yl] trifluoromethanesulfonate (CID 155046569) is [5-[1-(dimethoxyphosphorylmethyl)pyridin-1-ium-4-yl]-1,2,4-thiadiazol-3-yl] trifluoromethanesulfonate.
What is the SMILES notation for [5-[1-(dimethoxyphosphorylmethyl)pyridin-1-ium-4-yl]-1,2,4-thiadiazol-3-yl] trifluoromethanesulfonate?
The canonical SMILES for [5-[1-(dimethoxyphosphorylmethyl)pyridin-1-ium-4-yl]-1,2,4-thiadiazol-3-yl] trifluoromethanesulfonate is COP(=O)(C[n+]1ccc(-c2nc(OS(=O)(=O)C(F)(F)F)ns2)cc1)OC.
What is the InChIKey of [5-[1-(dimethoxyphosphorylmethyl)pyridin-1-ium-4-yl]-1,2,4-thiadiazol-3-yl] trifluoromethanesulfonate?
The InChIKey is MOSGXYOEVGDGFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3N3O6PS2/c1-21-24(18,22-2)7-17-5-3-8(4-6-17)9-15-10(16-25-9)23-26(19,20)11(12,13)14/h3-6H,7H2,1-2H3/q+1.
What are the key properties of [5-[1-(dimethoxyphosphorylmethyl)pyridin-1-ium-4-yl]-1,2,4-thiadiazol-3-yl] trifluoromethanesulfonate?
[5-[1-(dimethoxyphosphorylmethyl)pyridin-1-ium-4-yl]-1,2,4-thiadiazol-3-yl] trifluoromethanesulfonate has a molecular weight of 434.33 g/mol, XLogP of 2.16, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[1-(dimethoxyphosphorylmethyl)pyridin-1-ium-4-yl]-1,2,4-thiadiazol-3-yl] trifluoromethanesulfonate is sourced from PubChem (CID 155046569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).