C9H9F3N4OS — CID 155046577
2-sulfanylidene-1-[1-(trifluoromethyl)pyrazol-3-yl]pyrrolidine-3-carboxamide (PubChem CID 155046577) has the molecular formula C9H9F3N4OS and a molecular weight of 278.26 g/mol. Its IUPAC name is 2-sulfanylidene-1-[1-(trifluoromethyl)pyrazol-3-yl]pyrrolidine-3-carboxamide.
| Compound Name | 2-sulfanylidene-1-[1-(trifluoromethyl)pyrazol-3-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 155046577 |
| Molecular Formula | C9H9F3N4OS |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 2-sulfanylidene-1-[1-(trifluoromethyl)pyrazol-3-yl]pyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CCN(c2ccn(C(F)(F)F)n2)C1=S |
| InChI | InChI=1S/C9H9F3N4OS/c10-9(11,12)16-4-2-6(14-16)15-3-1-5(7(13)17)8(15)18/h2,4-5H,1,3H2,(H2,13,17) |
| InChIKey | AKSAEKWZRGTEJA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|