About methyl 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylate;trifluoromethanesulfonate
methyl 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylate;trifluoromethanesulfonate (PubChem CID 155046629) has the molecular formula C10H13F3N2O6S
and a molecular weight of 346.28 g/mol. Its IUPAC name is methyl 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylate;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | methyl 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylate;trifluoromethanesulfonate |
| PubChem CID | 155046629 |
| Molecular Formula | C10H13F3N2O6S |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | methyl 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylate;trifluoromethanesulfonate |
| SMILES | COCC[n+]1ccc(C(=O)OC)cn1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C9H13N2O3.CHF3O3S/c1-13-6-5-11-4-3-8(7-10-11)9(12)14-2;2-1(3,4)8(5,6)7/h3-4,7H,5-6H2,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | FARFIGBKHNKNFF-UHFFFAOYSA-M |
| XLogP | -0.15 |
| TPSA | 109.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylate;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylate;trifluoromethanesulfonate?
The IUPAC name of methyl 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylate;trifluoromethanesulfonate (CID 155046629) is methyl 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylate;trifluoromethanesulfonate.
What is the SMILES notation for methyl 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylate;trifluoromethanesulfonate?
The canonical SMILES for methyl 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylate;trifluoromethanesulfonate is COCC[n+]1ccc(C(=O)OC)cn1.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of methyl 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylate;trifluoromethanesulfonate?
The InChIKey is FARFIGBKHNKNFF-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H13N2O3.CHF3O3S/c1-13-6-5-11-4-3-8(7-10-11)9(12)14-2;2-1(3,4)8(5,6)7/h3-4,7H,5-6H2,1-2H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of methyl 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylate;trifluoromethanesulfonate?
methyl 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylate;trifluoromethanesulfonate has a molecular weight of 346.28 g/mol, XLogP of -0.15, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(2-methoxyethyl)pyridazin-1-ium-4-carboxylate;trifluoromethanesulfonate is sourced from PubChem (CID 155046629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).