C12H8F5NS — CID 15504701
2,5-dimethyl-3-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1H-pyrrole (PubChem CID 15504701) has the molecular formula C12H8F5NS and a molecular weight of 293.26 g/mol. Its IUPAC name is 2,5-dimethyl-3-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1H-pyrrole.
| Compound Name | 2,5-dimethyl-3-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1H-pyrrole |
|---|---|
| PubChem CID | 15504701 |
| Molecular Formula | C12H8F5NS |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 2,5-dimethyl-3-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1H-pyrrole |
| SMILES | Cc1cc(Sc2c(F)c(F)c(F)c(F)c2F)c(C)[nH]1 |
| InChI | InChI=1S/C12H8F5NS/c1-4-3-6(5(2)18-4)19-12-10(16)8(14)7(13)9(15)11(12)17/h3,18H,1-2H3 |
| InChIKey | KPCNKFGGGTWXMM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|