About (1S,5R)-6,6-difluoro-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylic acid
(1S,5R)-6,6-difluoro-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylic acid (PubChem CID 155047192) has the molecular formula C8H9F2NO3
and a molecular weight of 205.16 g/mol. Its IUPAC name is (1S,5R)-6,6-difluoro-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylic acid.
Molecular Properties
| Compound Name | (1S,5R)-6,6-difluoro-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylic acid |
| PubChem CID | 155047192 |
| Molecular Formula | C8H9F2NO3 |
| Molecular Weight | 205.16 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | (1S,5R)-6,6-difluoro-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylic acid |
| SMILES | O=C1C[C@H]2CC(F)(F)[C@@H](C1)N2C(=O)O |
| InChI | InChI=1S/C8H9F2NO3/c9-8(10)3-4-1-5(12)2-6(8)11(4)7(13)14/h4,6H,1-3H2,(H,13,14)/t4-,6+/m0/s1 |
| InChIKey | PBTUVRPMNCKJHG-UJURSFKZSA-N |
| XLogP | 1.11 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.16 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,5R)-6,6-difluoro-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-6,6-difluoro-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylic acid?
The IUPAC name of (1S,5R)-6,6-difluoro-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylic acid (CID 155047192) is (1S,5R)-6,6-difluoro-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylic acid.
What is the SMILES notation for (1S,5R)-6,6-difluoro-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylic acid?
The canonical SMILES for (1S,5R)-6,6-difluoro-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylic acid is O=C1C[C@H]2CC(F)(F)[C@@H](C1)N2C(=O)O.
What is the InChIKey of (1S,5R)-6,6-difluoro-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylic acid?
The InChIKey is PBTUVRPMNCKJHG-UJURSFKZSA-N. The full InChI is InChI=1S/C8H9F2NO3/c9-8(10)3-4-1-5(12)2-6(8)11(4)7(13)14/h4,6H,1-3H2,(H,13,14)/t4-,6+/m0/s1.
What are the key properties of (1S,5R)-6,6-difluoro-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylic acid?
(1S,5R)-6,6-difluoro-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylic acid has a molecular weight of 205.16 g/mol, XLogP of 1.11, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-6,6-difluoro-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylic acid is sourced from PubChem (CID 155047192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).