About di(cyclopenta-2,4-dien-1-yl)phosphane
di(cyclopenta-2,4-dien-1-yl)phosphane (PubChem CID 15504820) has the molecular formula C10H11P
and a molecular weight of 162.17 g/mol. Its IUPAC name is di(cyclopenta-2,4-dien-1-yl)phosphane.
Molecular Properties
| Compound Name | di(cyclopenta-2,4-dien-1-yl)phosphane |
| PubChem CID | 15504820 |
| Molecular Formula | C10H11P |
| Molecular Weight | 162.17 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | di(cyclopenta-2,4-dien-1-yl)phosphane |
| SMILES | C1=CC(PC2C=CC=C2)C=C1 |
| InChI | InChI=1S/C10H11P/c1-2-6-9(5-1)11-10-7-3-4-8-10/h1-11H |
| InChIKey | QQWORGZKNSYUKW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.17 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze di(cyclopenta-2,4-dien-1-yl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(cyclopenta-2,4-dien-1-yl)phosphane?
The IUPAC name of di(cyclopenta-2,4-dien-1-yl)phosphane (CID 15504820) is di(cyclopenta-2,4-dien-1-yl)phosphane.
What is the SMILES notation for di(cyclopenta-2,4-dien-1-yl)phosphane?
The canonical SMILES for di(cyclopenta-2,4-dien-1-yl)phosphane is C1=CC(PC2C=CC=C2)C=C1.
What is the InChIKey of di(cyclopenta-2,4-dien-1-yl)phosphane?
The InChIKey is QQWORGZKNSYUKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11P/c1-2-6-9(5-1)11-10-7-3-4-8-10/h1-11H.
What are the key properties of di(cyclopenta-2,4-dien-1-yl)phosphane?
di(cyclopenta-2,4-dien-1-yl)phosphane has a molecular weight of 162.17 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for di(cyclopenta-2,4-dien-1-yl)phosphane is sourced from PubChem (CID 15504820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).