C28H25BrO4 — CID 15504914
6-(4-bromophenyl)-3,5,5-trimethyl-3-[2-oxo-2-(4-phenylphenyl)ethyl]oxane-2,4-dione (PubChem CID 15504914) has the molecular formula C28H25BrO4 and a molecular weight of 505.41 g/mol. Its IUPAC name is 6-(4-bromophenyl)-3,5,5-trimethyl-3-[2-oxo-2-(4-phenylphenyl)ethyl]oxane-2,4-dione.
| Compound Name | 6-(4-bromophenyl)-3,5,5-trimethyl-3-[2-oxo-2-(4-phenylphenyl)ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 15504914 |
| Molecular Formula | C28H25BrO4 |
| Molecular Weight | 505.41 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | 6-(4-bromophenyl)-3,5,5-trimethyl-3-[2-oxo-2-(4-phenylphenyl)ethyl]oxane-2,4-dione |
| SMILES | CC1(CC(=O)c2ccc(-c3ccccc3)cc2)C(=O)OC(c2ccc(Br)cc2)C(C)(C)C1=O |
| InChI | InChI=1S/C28H25BrO4/c1-27(2)24(21-13-15-22(29)16-14-21)33-26(32)28(3,25(27)31)17-23(30)20-11-9-19(10-12-20)18-7-5-4-6-8-18/h4-16,24H,17H2,1-3H3 |
| InChIKey | IOUQGBHRSMRBHW-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.41 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|