C14H20FN — CID 155049255
(2Z,4E,8E)-5-fluoro-6-methylidenetrideca-2,4,8-trien-7-imine (PubChem CID 155049255) has the molecular formula C14H20FN and a molecular weight of 221.32 g/mol. Its IUPAC name is (2Z,4E,8E)-5-fluoro-6-methylidenetrideca-2,4,8-trien-7-imine.
| Compound Name | (2Z,4E,8E)-5-fluoro-6-methylidenetrideca-2,4,8-trien-7-imine |
|---|---|
| PubChem CID | 155049255 |
| Molecular Formula | C14H20FN |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | (2Z,4E,8E)-5-fluoro-6-methylidenetrideca-2,4,8-trien-7-imine |
| SMILES | [H]N=C(/C=C/CCCC)C(=C)/C(F)=C\C=C/C |
| InChI | InChI=1S/C14H20FN/c1-4-6-8-9-11-14(16)12(3)13(15)10-7-5-2/h5,7,9-11,16H,3-4,6,8H2,1-2H3/b7-5-,11-9+,13-10+,16-14+ |
| InChIKey | BTLIJJQQGFBANG-HKKBPEEYSA-N |
| XLogP | 4.74 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|