About N'-(5-bromo-2,4-dimethylphenyl)methanediimine
N'-(5-bromo-2,4-dimethylphenyl)methanediimine (PubChem CID 155049486) has the molecular formula C9H9BrN2
and a molecular weight of 225.09 g/mol. Its IUPAC name is N'-(5-bromo-2,4-dimethylphenyl)methanediimine.
Molecular Properties
| Compound Name | N'-(5-bromo-2,4-dimethylphenyl)methanediimine |
| PubChem CID | 155049486 |
| Molecular Formula | C9H9BrN2 |
| Molecular Weight | 225.09 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | N'-(5-bromo-2,4-dimethylphenyl)methanediimine |
| SMILES | Cc1cc(C)c(N=C=N)cc1Br |
| InChI | InChI=1S/C9H9BrN2/c1-6-3-7(2)9(12-5-11)4-8(6)10/h3-4,11H,1-2H3 |
| InChIKey | GUNKJAOSWOFFBW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.09 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N'-(5-bromo-2,4-dimethylphenyl)methanediimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-bromo-2,4-dimethylphenyl)methanediimine?
The IUPAC name of N'-(5-bromo-2,4-dimethylphenyl)methanediimine (CID 155049486) is N'-(5-bromo-2,4-dimethylphenyl)methanediimine.
What is the SMILES notation for N'-(5-bromo-2,4-dimethylphenyl)methanediimine?
The canonical SMILES for N'-(5-bromo-2,4-dimethylphenyl)methanediimine is Cc1cc(C)c(N=C=N)cc1Br.
What is the InChIKey of N'-(5-bromo-2,4-dimethylphenyl)methanediimine?
The InChIKey is GUNKJAOSWOFFBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN2/c1-6-3-7(2)9(12-5-11)4-8(6)10/h3-4,11H,1-2H3.
What are the key properties of N'-(5-bromo-2,4-dimethylphenyl)methanediimine?
N'-(5-bromo-2,4-dimethylphenyl)methanediimine has a molecular weight of 225.09 g/mol, XLogP of 3.45, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-bromo-2,4-dimethylphenyl)methanediimine is sourced from PubChem (CID 155049486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).