C21H32O — CID 155049723
(2E,4E,6E)-2-[(2E)-2,5-dimethylhexa-2,4-dienoxy]-5,6,9-trimethyldeca-2,4,6,8-tetraene (PubChem CID 155049723) has the molecular formula C21H32O and a molecular weight of 300.49 g/mol. Its IUPAC name is (2E,4E,6E)-2-[(2E)-2,5-dimethylhexa-2,4-dienoxy]-5,6,9-trimethyldeca-2,4,6,8-tetraene.
| Compound Name | (2E,4E,6E)-2-[(2E)-2,5-dimethylhexa-2,4-dienoxy]-5,6,9-trimethyldeca-2,4,6,8-tetraene |
|---|---|
| PubChem CID | 155049723 |
| Molecular Formula | C21H32O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | (2E,4E,6E)-2-[(2E)-2,5-dimethylhexa-2,4-dienoxy]-5,6,9-trimethyldeca-2,4,6,8-tetraene |
| SMILES | CC(C)=C/C=C(\C)CO/C(C)=C/C=C(C)/C(C)=C/C=C(C)C |
| InChI | InChI=1S/C21H32O/c1-16(2)9-11-18(5)15-22-21(8)14-13-20(7)19(6)12-10-17(3)4/h9-14H,15H2,1-8H3/b18-11+,19-12+,20-13+,21-14+ |
| InChIKey | WZBQCJIINHJRCJ-LDXZQUSTSA-N |
| XLogP | 6.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|