C9H12F2O2S — CID 155049764
(3E,5Z)-8,8-difluoro-4-methylsulfonylocta-1,3,5-triene (PubChem CID 155049764) has the molecular formula C9H12F2O2S and a molecular weight of 222.26 g/mol. Its IUPAC name is (3E,5Z)-8,8-difluoro-4-methylsulfonylocta-1,3,5-triene.
| Compound Name | (3E,5Z)-8,8-difluoro-4-methylsulfonylocta-1,3,5-triene |
|---|---|
| PubChem CID | 155049764 |
| Molecular Formula | C9H12F2O2S |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | (3E,5Z)-8,8-difluoro-4-methylsulfonylocta-1,3,5-triene |
| SMILES | C=C/C=C(\C=C/CC(F)F)S(C)(=O)=O |
| InChI | InChI=1S/C9H12F2O2S/c1-3-5-8(14(2,12)13)6-4-7-9(10)11/h3-6,9H,1,7H2,2H3/b6-4-,8-5+ |
| InChIKey | VUCPOCUBIJSRBX-QXMOYCCXSA-N |
| XLogP | 2.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|