C45H28F3N5OS — CID 155050293
2-[7-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]dibenzofuran-4-yl]-4-[4-(trifluoromethyl)phenyl]-[1]benzothiolo[3,2-d]pyrimidine (PubChem CID 155050293) has the molecular formula C45H28F3N5OS and a molecular weight of 743.81 g/mol. Its IUPAC name is 2-[7-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]dibenzofuran-4-yl]-4-[4-(trifluoromethyl)phenyl]-[1]benzothiolo[3,2-d]pyrimidine.
| Compound Name | 2-[7-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]dibenzofuran-4-yl]-4-[4-(trifluoromethyl)phenyl]-[1]benzothiolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 155050293 |
| Molecular Formula | C45H28F3N5OS |
| Molecular Weight | 743.81 g/mol |
| Exact Mass | 743.20 |
| IUPAC Name | 2-[7-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]dibenzofuran-4-yl]-4-[4-(trifluoromethyl)phenyl]-[1]benzothiolo[3,2-d]pyrimidine |
| SMILES | C=C/C=C\C(=C/C)c1nc(-c2ccccc2)nc(-c2ccc3c(c2)oc2c(-c4nc(-c5ccc(C(F)(F)F)cc5)c5sc6ccccc6c5n4)cccc23)n1 |
| InChI | InChI=1S/C45H28F3N5OS/c1-3-5-12-26(4-2)41-51-42(28-13-7-6-8-14-28)53-43(52-41)29-21-24-31-32-16-11-17-34(39(32)54-35(31)25-29)44-49-37(27-19-22-30(23-20-27)45(46,47)48)40-38(50-44)33-15-9-10-18-36(33)55-40/h3-25H,1H2,2H3/b12-5-,26-4+ |
| InChIKey | NXWPFFNJWZWSQL-FHDUTPAMSA-N |
| XLogP | 12.76 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.81 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|