C43H27N5OS — CID 155050407
2-[6-(5-phenoxy-4-phenylpyrimidin-2-yl)dibenzothiophen-3-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 155050407) has the molecular formula C43H27N5OS and a molecular weight of 661.79 g/mol. Its IUPAC name is 2-[6-(5-phenoxy-4-phenylpyrimidin-2-yl)dibenzothiophen-3-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[6-(5-phenoxy-4-phenylpyrimidin-2-yl)dibenzothiophen-3-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 155050407 |
| Molecular Formula | C43H27N5OS |
| Molecular Weight | 661.79 g/mol |
| Exact Mass | 661.19 |
| IUPAC Name | 2-[6-(5-phenoxy-4-phenylpyrimidin-2-yl)dibenzothiophen-3-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(Oc2cnc(-c3cccc4c3sc3cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)ccc34)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C43H27N5OS/c1-5-14-28(15-6-1)38-36(49-32-20-11-4-12-21-32)27-44-43(45-38)35-23-13-22-34-33-25-24-31(26-37(33)50-39(34)35)42-47-40(29-16-7-2-8-17-29)46-41(48-42)30-18-9-3-10-19-30/h1-27H |
| InChIKey | RHWKCKOLMHULCM-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 73.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.79 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |