C44H26F3N5S2 — CID 155050480
2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]-4-[(1E,3E)-4-(trifluoromethyl)hexa-1,3,5-trienyl]-[1]benzothiolo[3,2-d]pyrimidine (PubChem CID 155050480) has the molecular formula C44H26F3N5S2 and a molecular weight of 745.86 g/mol. Its IUPAC name is 2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]-4-[(1E,3E)-4-(trifluoromethyl)hexa-1,3,5-trienyl]-[1]benzothiolo[3,2-d]pyrimidine.
| Compound Name | 2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]-4-[(1E,3E)-4-(trifluoromethyl)hexa-1,3,5-trienyl]-[1]benzothiolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 155050480 |
| Molecular Formula | C44H26F3N5S2 |
| Molecular Weight | 745.86 g/mol |
| Exact Mass | 745.16 |
| IUPAC Name | 2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]-4-[(1E,3E)-4-(trifluoromethyl)hexa-1,3,5-trienyl]-[1]benzothiolo[3,2-d]pyrimidine |
| SMILES | C=C/C(=C\C=C\c1nc(-c2cccc3c2sc2cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c23)nc2c1sc1ccccc12)C(F)(F)F |
| InChI | InChI=1S/C44H26F3N5S2/c1-2-28(44(45,46)47)18-11-23-33-39-37(29-19-9-10-24-34(29)53-39)49-43(48-33)32-22-12-20-30-36-31(21-13-25-35(36)54-38(30)32)42-51-40(26-14-5-3-6-15-26)50-41(52-42)27-16-7-4-8-17-27/h2-25H,1H2/b23-11+,28-18+ |
| InChIKey | YSKCKFBCPVDFCC-XNVKBPHKSA-N |
| XLogP | 12.75 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.86 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|