About (2R,6S)-2-(3,3-dimethylcyclooctyl)-6-(hydroxymethyl)oxan-4-ol
(2R,6S)-2-(3,3-dimethylcyclooctyl)-6-(hydroxymethyl)oxan-4-ol (PubChem CID 155050823) has the molecular formula C16H30O3
and a molecular weight of 270.41 g/mol. Its IUPAC name is (2R,6S)-2-(3,3-dimethylcyclooctyl)-6-(hydroxymethyl)oxan-4-ol.
Molecular Properties
| Compound Name | (2R,6S)-2-(3,3-dimethylcyclooctyl)-6-(hydroxymethyl)oxan-4-ol |
| PubChem CID | 155050823 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | (2R,6S)-2-(3,3-dimethylcyclooctyl)-6-(hydroxymethyl)oxan-4-ol |
| SMILES | CC1(C)CCCCCC([C@H]2CC(O)C[C@@H](CO)O2)C1 |
| InChI | InChI=1S/C16H30O3/c1-16(2)7-5-3-4-6-12(10-16)15-9-13(18)8-14(11-17)19-15/h12-15,17-18H,3-11H2,1-2H3/t12?,13?,14-,15+/m0/s1 |
| InChIKey | JGESPLVLRKJXDG-PFSRBDOWSA-N |
| XLogP | 2.88 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,6S)-2-(3,3-dimethylcyclooctyl)-6-(hydroxymethyl)oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-2-(3,3-dimethylcyclooctyl)-6-(hydroxymethyl)oxan-4-ol?
The IUPAC name of (2R,6S)-2-(3,3-dimethylcyclooctyl)-6-(hydroxymethyl)oxan-4-ol (CID 155050823) is (2R,6S)-2-(3,3-dimethylcyclooctyl)-6-(hydroxymethyl)oxan-4-ol.
What is the SMILES notation for (2R,6S)-2-(3,3-dimethylcyclooctyl)-6-(hydroxymethyl)oxan-4-ol?
The canonical SMILES for (2R,6S)-2-(3,3-dimethylcyclooctyl)-6-(hydroxymethyl)oxan-4-ol is CC1(C)CCCCCC([C@H]2CC(O)C[C@@H](CO)O2)C1.
What is the InChIKey of (2R,6S)-2-(3,3-dimethylcyclooctyl)-6-(hydroxymethyl)oxan-4-ol?
The InChIKey is JGESPLVLRKJXDG-PFSRBDOWSA-N. The full InChI is InChI=1S/C16H30O3/c1-16(2)7-5-3-4-6-12(10-16)15-9-13(18)8-14(11-17)19-15/h12-15,17-18H,3-11H2,1-2H3/t12?,13?,14-,15+/m0/s1.
What are the key properties of (2R,6S)-2-(3,3-dimethylcyclooctyl)-6-(hydroxymethyl)oxan-4-ol?
(2R,6S)-2-(3,3-dimethylcyclooctyl)-6-(hydroxymethyl)oxan-4-ol has a molecular weight of 270.41 g/mol, XLogP of 2.88, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-2-(3,3-dimethylcyclooctyl)-6-(hydroxymethyl)oxan-4-ol is sourced from PubChem (CID 155050823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).