About (3S)-6-chloro-3,7-dimethyl-2,3-dihydrothiepine
(3S)-6-chloro-3,7-dimethyl-2,3-dihydrothiepine (PubChem CID 155050833) has the molecular formula C8H11ClS
and a molecular weight of 174.70 g/mol. Its IUPAC name is (3S)-6-chloro-3,7-dimethyl-2,3-dihydrothiepine.
Molecular Properties
| Compound Name | (3S)-6-chloro-3,7-dimethyl-2,3-dihydrothiepine |
| PubChem CID | 155050833 |
| Molecular Formula | C8H11ClS |
| Molecular Weight | 174.70 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | (3S)-6-chloro-3,7-dimethyl-2,3-dihydrothiepine |
| SMILES | CC1=C(Cl)C=C[C@H](C)CS1 |
| InChI | InChI=1S/C8H11ClS/c1-6-3-4-8(9)7(2)10-5-6/h3-4,6H,5H2,1-2H3/t6-/m0/s1 |
| InChIKey | RFHKPUMRRVRBQP-LURJTMIESA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.70 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S)-6-chloro-3,7-dimethyl-2,3-dihydrothiepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-6-chloro-3,7-dimethyl-2,3-dihydrothiepine?
The IUPAC name of (3S)-6-chloro-3,7-dimethyl-2,3-dihydrothiepine (CID 155050833) is (3S)-6-chloro-3,7-dimethyl-2,3-dihydrothiepine.
What is the SMILES notation for (3S)-6-chloro-3,7-dimethyl-2,3-dihydrothiepine?
The canonical SMILES for (3S)-6-chloro-3,7-dimethyl-2,3-dihydrothiepine is CC1=C(Cl)C=C[C@H](C)CS1.
What is the InChIKey of (3S)-6-chloro-3,7-dimethyl-2,3-dihydrothiepine?
The InChIKey is RFHKPUMRRVRBQP-LURJTMIESA-N. The full InChI is InChI=1S/C8H11ClS/c1-6-3-4-8(9)7(2)10-5-6/h3-4,6H,5H2,1-2H3/t6-/m0/s1.
What are the key properties of (3S)-6-chloro-3,7-dimethyl-2,3-dihydrothiepine?
(3S)-6-chloro-3,7-dimethyl-2,3-dihydrothiepine has a molecular weight of 174.70 g/mol, XLogP of 3.40, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-6-chloro-3,7-dimethyl-2,3-dihydrothiepine is sourced from PubChem (CID 155050833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).