About 4,5-dimethyl-3-azabicyclo[4.2.0]octa-1,3,5-triene
4,5-dimethyl-3-azabicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 155051971) has the molecular formula C9H11N
and a molecular weight of 133.19 g/mol. Its IUPAC name is 4,5-dimethyl-3-azabicyclo[4.2.0]octa-1,3,5-triene.
Molecular Properties
| Compound Name | 4,5-dimethyl-3-azabicyclo[4.2.0]octa-1,3,5-triene |
| PubChem CID | 155051971 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 4,5-dimethyl-3-azabicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | Cc1ncc2c(c1C)CC2 |
| InChI | InChI=1S/C9H11N/c1-6-7(2)10-5-8-3-4-9(6)8/h5H,3-4H2,1-2H3 |
| InChIKey | ZFHXHGJKPHDOMR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,5-dimethyl-3-azabicyclo[4.2.0]octa-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-3-azabicyclo[4.2.0]octa-1,3,5-triene?
The IUPAC name of 4,5-dimethyl-3-azabicyclo[4.2.0]octa-1,3,5-triene (CID 155051971) is 4,5-dimethyl-3-azabicyclo[4.2.0]octa-1,3,5-triene.
What is the SMILES notation for 4,5-dimethyl-3-azabicyclo[4.2.0]octa-1,3,5-triene?
The canonical SMILES for 4,5-dimethyl-3-azabicyclo[4.2.0]octa-1,3,5-triene is Cc1ncc2c(c1C)CC2.
What is the InChIKey of 4,5-dimethyl-3-azabicyclo[4.2.0]octa-1,3,5-triene?
The InChIKey is ZFHXHGJKPHDOMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N/c1-6-7(2)10-5-8-3-4-9(6)8/h5H,3-4H2,1-2H3.
What are the key properties of 4,5-dimethyl-3-azabicyclo[4.2.0]octa-1,3,5-triene?
4,5-dimethyl-3-azabicyclo[4.2.0]octa-1,3,5-triene has a molecular weight of 133.19 g/mol, XLogP of 1.80, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-3-azabicyclo[4.2.0]octa-1,3,5-triene is sourced from PubChem (CID 155051971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).