C21H27ClN8O3S — CID 155052206
5-[3-[3-(5-chloropyrimidin-2-yl)butan-2-ylsulfanylamino]-5-[(Z)-5-methoxypent-3-en-2-yl]-1,2,4-triazol-4-yl]-4-methoxy-1H-pyrimidin-6-one (PubChem CID 155052206) has the molecular formula C21H27ClN8O3S and a molecular weight of 507.02 g/mol. Its IUPAC name is 5-[3-[3-(5-chloropyrimidin-2-yl)butan-2-ylsulfanylamino]-5-[(Z)-5-methoxypent-3-en-2-yl]-1,2,4-triazol-4-yl]-4-methoxy-1H-pyrimidin-6-one.
| Compound Name | 5-[3-[3-(5-chloropyrimidin-2-yl)butan-2-ylsulfanylamino]-5-[(Z)-5-methoxypent-3-en-2-yl]-1,2,4-triazol-4-yl]-4-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 155052206 |
| Molecular Formula | C21H27ClN8O3S |
| Molecular Weight | 507.02 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | 5-[3-[3-(5-chloropyrimidin-2-yl)butan-2-ylsulfanylamino]-5-[(Z)-5-methoxypent-3-en-2-yl]-1,2,4-triazol-4-yl]-4-methoxy-1H-pyrimidin-6-one |
| SMILES | COC/C=C\C(C)c1nnc(NSC(C)C(C)c2ncc(Cl)cn2)n1-c1c(OC)nc[nH]c1=O |
| InChI | InChI=1S/C21H27ClN8O3S/c1-12(7-6-8-32-4)18-27-28-21(30(18)16-19(31)25-11-26-20(16)33-5)29-34-14(3)13(2)17-23-9-15(22)10-24-17/h6-7,9-14H,8H2,1-5H3,(H,28,29)(H,25,26,31)/b7-6- |
| InChIKey | ZLIRQCBCYWQTLZ-SREVYHEPSA-N |
| XLogP | 3.36 |
| TPSA | 132.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.02 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|