C20H32N6O2S — CID 155052208
5-(4-methoxybutyl)-N-[1-methoxy-1-(5-methylpyrazin-2-yl)propan-2-yl]sulfanyl-4-(1-methylcyclopropyl)-1,2,4-triazol-3-amine (PubChem CID 155052208) has the molecular formula C20H32N6O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is 5-(4-methoxybutyl)-N-[1-methoxy-1-(5-methylpyrazin-2-yl)propan-2-yl]sulfanyl-4-(1-methylcyclopropyl)-1,2,4-triazol-3-amine.
| Compound Name | 5-(4-methoxybutyl)-N-[1-methoxy-1-(5-methylpyrazin-2-yl)propan-2-yl]sulfanyl-4-(1-methylcyclopropyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 155052208 |
| Molecular Formula | C20H32N6O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 5-(4-methoxybutyl)-N-[1-methoxy-1-(5-methylpyrazin-2-yl)propan-2-yl]sulfanyl-4-(1-methylcyclopropyl)-1,2,4-triazol-3-amine |
| SMILES | COCCCCc1nnc(NSC(C)C(OC)c2cnc(C)cn2)n1C1(C)CC1 |
| InChI | InChI=1S/C20H32N6O2S/c1-14-12-22-16(13-21-14)18(28-5)15(2)29-25-19-24-23-17(8-6-7-11-27-4)26(19)20(3)9-10-20/h12-13,15,18H,6-11H2,1-5H3,(H,24,25) |
| InChIKey | KYQYQAOQPNAQCR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|