C20H25ClN8O3S — CID 155052215
5-[3-[3-(5-chloropyrimidin-2-yl)butan-2-ylsulfanylamino]-5-[(Z)-4-methoxybut-2-enyl]-1,2,4-triazol-4-yl]-4-methoxy-1H-pyrimidin-6-one (PubChem CID 155052215) has the molecular formula C20H25ClN8O3S and a molecular weight of 492.99 g/mol. Its IUPAC name is 5-[3-[3-(5-chloropyrimidin-2-yl)butan-2-ylsulfanylamino]-5-[(Z)-4-methoxybut-2-enyl]-1,2,4-triazol-4-yl]-4-methoxy-1H-pyrimidin-6-one.
| Compound Name | 5-[3-[3-(5-chloropyrimidin-2-yl)butan-2-ylsulfanylamino]-5-[(Z)-4-methoxybut-2-enyl]-1,2,4-triazol-4-yl]-4-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 155052215 |
| Molecular Formula | C20H25ClN8O3S |
| Molecular Weight | 492.99 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 5-[3-[3-(5-chloropyrimidin-2-yl)butan-2-ylsulfanylamino]-5-[(Z)-4-methoxybut-2-enyl]-1,2,4-triazol-4-yl]-4-methoxy-1H-pyrimidin-6-one |
| SMILES | COC/C=C\Cc1nnc(NSC(C)C(C)c2ncc(Cl)cn2)n1-c1c(OC)nc[nH]c1=O |
| InChI | InChI=1S/C20H25ClN8O3S/c1-12(17-22-9-14(21)10-23-17)13(2)33-28-20-27-26-15(7-5-6-8-31-3)29(20)16-18(30)24-11-25-19(16)32-4/h5-6,9-13H,7-8H2,1-4H3,(H,27,28)(H,24,25,30)/b6-5- |
| InChIKey | ZRJGWPQJYCCHHN-WAYWQWQTSA-N |
| XLogP | 2.80 |
| TPSA | 132.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.99 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|