C11H18N2 — CID 155052430
N'-[(4Z)-hepta-1,2,4,6-tetraen-3-yl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 155052430) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is N'-[(4Z)-hepta-1,2,4,6-tetraen-3-yl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[(4Z)-hepta-1,2,4,6-tetraen-3-yl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 155052430 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | N'-[(4Z)-hepta-1,2,4,6-tetraen-3-yl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | C=C=C(/C=C\C=C)N(C)CCNC |
| InChI | InChI=1S/C11H18N2/c1-5-7-8-11(6-2)13(4)10-9-12-3/h5,7-8,12H,1-2,9-10H2,3-4H3/b8-7- |
| InChIKey | UWUCSEPWBHUYQN-FPLPWBNLSA-N |
| XLogP | 1.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|