About (3E)-3-[(Z)-1-(2-chloro-4-methylanilino)prop-1-enyl]-6-methylhepta-3,5-dien-2-one
(3E)-3-[(Z)-1-(2-chloro-4-methylanilino)prop-1-enyl]-6-methylhepta-3,5-dien-2-one (PubChem CID 155052705) has the molecular formula C18H22ClNO
and a molecular weight of 303.83 g/mol. Its IUPAC name is (3E)-3-[(Z)-1-(2-chloro-4-methylanilino)prop-1-enyl]-6-methylhepta-3,5-dien-2-one.
Molecular Properties
| Compound Name | (3E)-3-[(Z)-1-(2-chloro-4-methylanilino)prop-1-enyl]-6-methylhepta-3,5-dien-2-one |
| PubChem CID | 155052705 |
| Molecular Formula | C18H22ClNO |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (3E)-3-[(Z)-1-(2-chloro-4-methylanilino)prop-1-enyl]-6-methylhepta-3,5-dien-2-one |
| SMILES | C/C=C(Nc1ccc(C)cc1Cl)/C(=C\C=C(C)C)C(C)=O |
| InChI | InChI=1S/C18H22ClNO/c1-6-17(15(14(5)21)9-7-12(2)3)20-18-10-8-13(4)11-16(18)19/h6-11,20H,1-5H3/b15-9-,17-6- |
| InChIKey | SZWVKXJOOZRAMN-NYRWMROISA-N |
| XLogP | 5.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-[(Z)-1-(2-chloro-4-methylanilino)prop-1-enyl]-6-methylhepta-3,5-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-[(Z)-1-(2-chloro-4-methylanilino)prop-1-enyl]-6-methylhepta-3,5-dien-2-one?
The IUPAC name of (3E)-3-[(Z)-1-(2-chloro-4-methylanilino)prop-1-enyl]-6-methylhepta-3,5-dien-2-one (CID 155052705) is (3E)-3-[(Z)-1-(2-chloro-4-methylanilino)prop-1-enyl]-6-methylhepta-3,5-dien-2-one.
What is the SMILES notation for (3E)-3-[(Z)-1-(2-chloro-4-methylanilino)prop-1-enyl]-6-methylhepta-3,5-dien-2-one?
The canonical SMILES for (3E)-3-[(Z)-1-(2-chloro-4-methylanilino)prop-1-enyl]-6-methylhepta-3,5-dien-2-one is C/C=C(Nc1ccc(C)cc1Cl)/C(=C\C=C(C)C)C(C)=O.
What is the InChIKey of (3E)-3-[(Z)-1-(2-chloro-4-methylanilino)prop-1-enyl]-6-methylhepta-3,5-dien-2-one?
The InChIKey is SZWVKXJOOZRAMN-NYRWMROISA-N. The full InChI is InChI=1S/C18H22ClNO/c1-6-17(15(14(5)21)9-7-12(2)3)20-18-10-8-13(4)11-16(18)19/h6-11,20H,1-5H3/b15-9-,17-6-.
What are the key properties of (3E)-3-[(Z)-1-(2-chloro-4-methylanilino)prop-1-enyl]-6-methylhepta-3,5-dien-2-one?
(3E)-3-[(Z)-1-(2-chloro-4-methylanilino)prop-1-enyl]-6-methylhepta-3,5-dien-2-one has a molecular weight of 303.83 g/mol, XLogP of 5.45, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-[(Z)-1-(2-chloro-4-methylanilino)prop-1-enyl]-6-methylhepta-3,5-dien-2-one is sourced from PubChem (CID 155052705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).