About N,8a-dimethyl-8H-1,8-naphthyridin-3-amine
N,8a-dimethyl-8H-1,8-naphthyridin-3-amine (PubChem CID 155052951) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is N,8a-dimethyl-8H-1,8-naphthyridin-3-amine.
Molecular Properties
| Compound Name | N,8a-dimethyl-8H-1,8-naphthyridin-3-amine |
| PubChem CID | 155052951 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | N,8a-dimethyl-8H-1,8-naphthyridin-3-amine |
| SMILES | CNC1=CC2=CC=CNC2(C)N=C1 |
| InChI | InChI=1S/C10H13N3/c1-10-8(4-3-5-12-10)6-9(11-2)7-13-10/h3-7,11-12H,1-2H3 |
| InChIKey | HEQMTUXSVRPASG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,8a-dimethyl-8H-1,8-naphthyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,8a-dimethyl-8H-1,8-naphthyridin-3-amine?
The IUPAC name of N,8a-dimethyl-8H-1,8-naphthyridin-3-amine (CID 155052951) is N,8a-dimethyl-8H-1,8-naphthyridin-3-amine.
What is the SMILES notation for N,8a-dimethyl-8H-1,8-naphthyridin-3-amine?
The canonical SMILES for N,8a-dimethyl-8H-1,8-naphthyridin-3-amine is CNC1=CC2=CC=CNC2(C)N=C1.
What is the InChIKey of N,8a-dimethyl-8H-1,8-naphthyridin-3-amine?
The InChIKey is HEQMTUXSVRPASG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-10-8(4-3-5-12-10)6-9(11-2)7-13-10/h3-7,11-12H,1-2H3.
What are the key properties of N,8a-dimethyl-8H-1,8-naphthyridin-3-amine?
N,8a-dimethyl-8H-1,8-naphthyridin-3-amine has a molecular weight of 175.23 g/mol, XLogP of 0.93, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,8a-dimethyl-8H-1,8-naphthyridin-3-amine is sourced from PubChem (CID 155052951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).