C22H26N10O13P2 — CID 155053142
2-amino-9-[8-(1,2-dihydroimidazo[2,1-f]purin-3-yl)-3,9,12,18-tetrahydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one (PubChem CID 155053142) has the molecular formula C22H26N10O13P2 and a molecular weight of 700.45 g/mol. Its IUPAC name is 2-amino-9-[8-(1,2-dihydroimidazo[2,1-f]purin-3-yl)-3,9,12,18-tetrahydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[8-(1,2-dihydroimidazo[2,1-f]purin-3-yl)-3,9,12,18-tetrahydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 155053142 |
| Molecular Formula | C22H26N10O13P2 |
| Molecular Weight | 700.45 g/mol |
| Exact Mass | 700.12 |
| IUPAC Name | 2-amino-9-[8-(1,2-dihydroimidazo[2,1-f]purin-3-yl)-3,9,12,18-tetrahydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2C2OC3COP(=O)(O)OC4C(COP(=O)(O)OC2C3O)OC(N2CNc3c2ncn2ccnc32)C4O)c(=O)[nH]1 |
| InChI | InChI=1S/C22H26N10O13P2/c23-22-28-18-11(19(35)29-22)26-7-32(18)21-15-12(33)8(42-21)3-40-46(36,37)44-14-9(4-41-47(38,39)45-15)43-20(13(14)34)31-6-25-10-16-24-1-2-30(16)5-27-17(10)31/h1-2,5,7-9,12-15,20-21,25,33-34H,3-4,6H2,(H,36,37)(H,38,39)(H3,23,28,29,35) |
| InChIKey | AZNDCKLWXSMNLK-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 305.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.45 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|