About bis(4-fluoropent-4-enyl) oxalate
bis(4-fluoropent-4-enyl) oxalate (PubChem CID 155053254) has the molecular formula C12H16F2O4
and a molecular weight of 262.25 g/mol. Its IUPAC name is bis(4-fluoropent-4-enyl) oxalate.
Molecular Properties
| Compound Name | bis(4-fluoropent-4-enyl) oxalate |
| PubChem CID | 155053254 |
| Molecular Formula | C12H16F2O4 |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | bis(4-fluoropent-4-enyl) oxalate |
| SMILES | C=C(F)CCCOC(=O)C(=O)OCCCC(=C)F |
| InChI | InChI=1S/C12H16F2O4/c1-9(13)5-3-7-17-11(15)12(16)18-8-4-6-10(2)14/h1-8H2 |
| InChIKey | VPZZOBKTXBMQEG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze bis(4-fluoropent-4-enyl) oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-fluoropent-4-enyl) oxalate?
The IUPAC name of bis(4-fluoropent-4-enyl) oxalate (CID 155053254) is bis(4-fluoropent-4-enyl) oxalate.
What is the SMILES notation for bis(4-fluoropent-4-enyl) oxalate?
The canonical SMILES for bis(4-fluoropent-4-enyl) oxalate is C=C(F)CCCOC(=O)C(=O)OCCCC(=C)F.
What is the InChIKey of bis(4-fluoropent-4-enyl) oxalate?
The InChIKey is VPZZOBKTXBMQEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2O4/c1-9(13)5-3-7-17-11(15)12(16)18-8-4-6-10(2)14/h1-8H2.
What are the key properties of bis(4-fluoropent-4-enyl) oxalate?
bis(4-fluoropent-4-enyl) oxalate has a molecular weight of 262.25 g/mol, XLogP of 2.60, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-fluoropent-4-enyl) oxalate is sourced from PubChem (CID 155053254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).