C13H24F3NO — CID 155053282
2-tert-butyl-4,4-dimethyl-N-(2,2,2-trifluoroethyl)pentanamide (PubChem CID 155053282) has the molecular formula C13H24F3NO and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-tert-butyl-4,4-dimethyl-N-(2,2,2-trifluoroethyl)pentanamide.
| Compound Name | 2-tert-butyl-4,4-dimethyl-N-(2,2,2-trifluoroethyl)pentanamide |
|---|---|
| PubChem CID | 155053282 |
| Molecular Formula | C13H24F3NO |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 2-tert-butyl-4,4-dimethyl-N-(2,2,2-trifluoroethyl)pentanamide |
| SMILES | CC(C)(C)CC(C(=O)NCC(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C13H24F3NO/c1-11(2,3)7-9(12(4,5)6)10(18)17-8-13(14,15)16/h9H,7-8H2,1-6H3,(H,17,18) |
| InChIKey | FJRIHEPSOZCNRP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |