C16H26N2S — CID 155053625
3-[(4Z,6Z)-3-methylideneocta-1,4,6-trien-2-yl]-1,1-dipropylthiourea (PubChem CID 155053625) has the molecular formula C16H26N2S and a molecular weight of 278.46 g/mol. Its IUPAC name is 3-[(4Z,6Z)-3-methylideneocta-1,4,6-trien-2-yl]-1,1-dipropylthiourea.
| Compound Name | 3-[(4Z,6Z)-3-methylideneocta-1,4,6-trien-2-yl]-1,1-dipropylthiourea |
|---|---|
| PubChem CID | 155053625 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 3-[(4Z,6Z)-3-methylideneocta-1,4,6-trien-2-yl]-1,1-dipropylthiourea |
| SMILES | C=C(/C=C\C=C/C)C(=C)NC(=S)N(CCC)CCC |
| InChI | InChI=1S/C16H26N2S/c1-6-9-10-11-14(4)15(5)17-16(19)18(12-7-2)13-8-3/h6,9-11H,4-5,7-8,12-13H2,1-3H3,(H,17,19)/b9-6-,11-10- |
| InChIKey | NCKWKFVECIQOOC-ONEMGQKZSA-N |
| XLogP | 4.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|