C39H42N4O4 — CID 155054037
9-[3-[1,8-diamino-10-(diethylamino)anthracen-9-yl]-2,4-dihydroxycyclobutyl]-10-[ethyl(methyl)amino]anthracene-1,8-diol (PubChem CID 155054037) has the molecular formula C39H42N4O4 and a molecular weight of 630.79 g/mol. Its IUPAC name is 9-[3-[1,8-diamino-10-(diethylamino)anthracen-9-yl]-2,4-dihydroxycyclobutyl]-10-[ethyl(methyl)amino]anthracene-1,8-diol.
| Compound Name | 9-[3-[1,8-diamino-10-(diethylamino)anthracen-9-yl]-2,4-dihydroxycyclobutyl]-10-[ethyl(methyl)amino]anthracene-1,8-diol |
|---|---|
| PubChem CID | 155054037 |
| Molecular Formula | C39H42N4O4 |
| Molecular Weight | 630.79 g/mol |
| Exact Mass | 630.32 |
| IUPAC Name | 9-[3-[1,8-diamino-10-(diethylamino)anthracen-9-yl]-2,4-dihydroxycyclobutyl]-10-[ethyl(methyl)amino]anthracene-1,8-diol |
| SMILES | CCN(C)c1c2cccc(O)c2c(C2C(O)C(c3c4c(N)cccc4c(N(CC)CC)c4cccc(N)c34)C2O)c2c(O)cccc12 |
| InChI | InChI=1S/C39H42N4O4/c1-5-42(4)36-22-14-10-18-26(44)30(22)33(31-23(36)15-11-19-27(31)45)35-38(46)34(39(35)47)32-28-20(12-8-16-24(28)40)37(43(6-2)7-3)21-13-9-17-25(41)29(21)32/h8-19,34-35,38-39,44-47H,5-7,40-41H2,1-4H3 |
| InChIKey | GFGUIAFSHURHOB-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.79 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|