About 7-(hydroxymethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde
7-(hydroxymethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde (PubChem CID 155054270) has the molecular formula C11H12O3
and a molecular weight of 192.21 g/mol. Its IUPAC name is 7-(hydroxymethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde.
Molecular Properties
| Compound Name | 7-(hydroxymethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde |
| PubChem CID | 155054270 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 7-(hydroxymethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde |
| SMILES | O=CC1COc2cc(CO)ccc2C1 |
| InChI | InChI=1S/C11H12O3/c12-5-8-1-2-10-3-9(6-13)7-14-11(10)4-8/h1-2,4,6,9,12H,3,5,7H2 |
| InChIKey | SQWXBNVASDVSHW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7-(hydroxymethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(hydroxymethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde?
The IUPAC name of 7-(hydroxymethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde (CID 155054270) is 7-(hydroxymethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde.
What is the SMILES notation for 7-(hydroxymethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde?
The canonical SMILES for 7-(hydroxymethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde is O=CC1COc2cc(CO)ccc2C1.
What is the InChIKey of 7-(hydroxymethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde?
The InChIKey is SQWXBNVASDVSHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3/c12-5-8-1-2-10-3-9(6-13)7-14-11(10)4-8/h1-2,4,6,9,12H,3,5,7H2.
What are the key properties of 7-(hydroxymethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde?
7-(hydroxymethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde has a molecular weight of 192.21 g/mol, XLogP of 0.93, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(hydroxymethyl)-3,4-dihydro-2H-chromene-3-carbaldehyde is sourced from PubChem (CID 155054270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).