C24H31FN2O2S — CID 155054285
2-[(5S,9R)-9-(5-fluoro-2-pyridinyl)-2,6-dioxaspiro[4.5]decan-9-yl]-N-(4,5,6,7-tetrahydro-2-benzothiophen-1-ylmethyl)ethanamine (PubChem CID 155054285) has the molecular formula C24H31FN2O2S and a molecular weight of 430.59 g/mol. Its IUPAC name is 2-[(5S,9R)-9-(5-fluoro-2-pyridinyl)-2,6-dioxaspiro[4.5]decan-9-yl]-N-(4,5,6,7-tetrahydro-2-benzothiophen-1-ylmethyl)ethanamine.
| Compound Name | 2-[(5S,9R)-9-(5-fluoro-2-pyridinyl)-2,6-dioxaspiro[4.5]decan-9-yl]-N-(4,5,6,7-tetrahydro-2-benzothiophen-1-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 155054285 |
| Molecular Formula | C24H31FN2O2S |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 2-[(5S,9R)-9-(5-fluoro-2-pyridinyl)-2,6-dioxaspiro[4.5]decan-9-yl]-N-(4,5,6,7-tetrahydro-2-benzothiophen-1-ylmethyl)ethanamine |
| SMILES | Fc1ccc([C@]2(CCNCc3scc4c3CCCC4)CCO[C@]3(CCOC3)C2)nc1 |
| InChI | InChI=1S/C24H31FN2O2S/c25-19-5-6-22(27-13-19)23(8-12-29-24(16-23)9-11-28-17-24)7-10-26-14-21-20-4-2-1-3-18(20)15-30-21/h5-6,13,15,26H,1-4,7-12,14,16-17H2/t23-,24-/m1/s1 |
| InChIKey | NWKQIRFWSXKXHI-DNQXCXABSA-N |
| XLogP | 4.55 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|