C9H10F6 — CID 155054334
5-tert-butyl-1,2,3,3,4,4-hexafluorocyclopentene (PubChem CID 155054334) has the molecular formula C9H10F6 and a molecular weight of 232.17 g/mol. Its IUPAC name is 5-tert-butyl-1,2,3,3,4,4-hexafluorocyclopentene.
| Compound Name | 5-tert-butyl-1,2,3,3,4,4-hexafluorocyclopentene |
|---|---|
| PubChem CID | 155054334 |
| Molecular Formula | C9H10F6 |
| Molecular Weight | 232.17 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 5-tert-butyl-1,2,3,3,4,4-hexafluorocyclopentene |
| SMILES | CC(C)(C)C1C(F)=C(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H10F6/c1-7(2,3)5-4(10)6(11)9(14,15)8(5,12)13/h5H,1-3H3 |
| InChIKey | DZUVTWHRBJINIB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.17 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|