C17H21F3N2O3 — CID 155054539
[3-hydroxy-3-[(2S)-1-(2-hydroxyethyl)piperidin-2-yl]azetidin-1-yl]-(2,3,4-trifluorophenyl)methanone (PubChem CID 155054539) has the molecular formula C17H21F3N2O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is [3-hydroxy-3-[(2S)-1-(2-hydroxyethyl)piperidin-2-yl]azetidin-1-yl]-(2,3,4-trifluorophenyl)methanone.
| Compound Name | [3-hydroxy-3-[(2S)-1-(2-hydroxyethyl)piperidin-2-yl]azetidin-1-yl]-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 155054539 |
| Molecular Formula | C17H21F3N2O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [3-hydroxy-3-[(2S)-1-(2-hydroxyethyl)piperidin-2-yl]azetidin-1-yl]-(2,3,4-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1F)N1CC(O)([C@@H]2CCCCN2CCO)C1 |
| InChI | InChI=1S/C17H21F3N2O3/c18-12-5-4-11(14(19)15(12)20)16(24)22-9-17(25,10-22)13-3-1-2-6-21(13)7-8-23/h4-5,13,23,25H,1-3,6-10H2/t13-/m0/s1 |
| InChIKey | KDUKNLRVKUKGGE-ZDUSSCGKSA-N |
| XLogP | 1.14 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|