About ethyl 6-oxo-7-oxa-2,5-diazaspiro[3.4]octane-2-carboxylate
ethyl 6-oxo-7-oxa-2,5-diazaspiro[3.4]octane-2-carboxylate (PubChem CID 155054862) has the molecular formula C8H12N2O4
and a molecular weight of 200.19 g/mol. Its IUPAC name is ethyl 6-oxo-7-oxa-2,5-diazaspiro[3.4]octane-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-oxo-7-oxa-2,5-diazaspiro[3.4]octane-2-carboxylate |
| PubChem CID | 155054862 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | ethyl 6-oxo-7-oxa-2,5-diazaspiro[3.4]octane-2-carboxylate |
| SMILES | CCOC(=O)N1CC2(COC(=O)N2)C1 |
| InChI | InChI=1S/C8H12N2O4/c1-2-13-7(12)10-3-8(4-10)5-14-6(11)9-8/h2-5H2,1H3,(H,9,11) |
| InChIKey | RABFUOVYISUMBW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 6-oxo-7-oxa-2,5-diazaspiro[3.4]octane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-oxo-7-oxa-2,5-diazaspiro[3.4]octane-2-carboxylate?
The IUPAC name of ethyl 6-oxo-7-oxa-2,5-diazaspiro[3.4]octane-2-carboxylate (CID 155054862) is ethyl 6-oxo-7-oxa-2,5-diazaspiro[3.4]octane-2-carboxylate.
What is the SMILES notation for ethyl 6-oxo-7-oxa-2,5-diazaspiro[3.4]octane-2-carboxylate?
The canonical SMILES for ethyl 6-oxo-7-oxa-2,5-diazaspiro[3.4]octane-2-carboxylate is CCOC(=O)N1CC2(COC(=O)N2)C1.
What is the InChIKey of ethyl 6-oxo-7-oxa-2,5-diazaspiro[3.4]octane-2-carboxylate?
The InChIKey is RABFUOVYISUMBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4/c1-2-13-7(12)10-3-8(4-10)5-14-6(11)9-8/h2-5H2,1H3,(H,9,11).
What are the key properties of ethyl 6-oxo-7-oxa-2,5-diazaspiro[3.4]octane-2-carboxylate?
ethyl 6-oxo-7-oxa-2,5-diazaspiro[3.4]octane-2-carboxylate has a molecular weight of 200.19 g/mol, XLogP of -0.06, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-oxo-7-oxa-2,5-diazaspiro[3.4]octane-2-carboxylate is sourced from PubChem (CID 155054862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).