C16H23BrS — CID 155054934
2-(2-bromophenyl)sulfanylethylcyclooctane (PubChem CID 155054934) has the molecular formula C16H23BrS and a molecular weight of 327.33 g/mol. Its IUPAC name is 2-(2-bromophenyl)sulfanylethylcyclooctane.
| Compound Name | 2-(2-bromophenyl)sulfanylethylcyclooctane |
|---|---|
| PubChem CID | 155054934 |
| Molecular Formula | C16H23BrS |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 2-(2-bromophenyl)sulfanylethylcyclooctane |
| SMILES | Brc1ccccc1SCCC1CCCCCCC1 |
| InChI | InChI=1S/C16H23BrS/c17-15-10-6-7-11-16(15)18-13-12-14-8-4-2-1-3-5-9-14/h6-7,10-11,14H,1-5,8-9,12-13H2 |
| InChIKey | XNNLPBNIGJRWBN-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |