About [(3E)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] but-3-enoate
[(3E)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] but-3-enoate (PubChem CID 155054936) has the molecular formula C12H16O5
and a molecular weight of 240.25 g/mol. Its IUPAC name is [(3E)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] but-3-enoate.
Molecular Properties
| Compound Name | [(3E)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] but-3-enoate |
| PubChem CID | 155054936 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | [(3E)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] but-3-enoate |
| SMILES | C=CCC(=O)OCC/C=C1/OC(=O)OC1(C)C |
| InChI | InChI=1S/C12H16O5/c1-4-6-10(13)15-8-5-7-9-12(2,3)17-11(14)16-9/h4,7H,1,5-6,8H2,2-3H3/b9-7+ |
| InChIKey | AIONFKHLCDQKPF-VQHVLOKHSA-N |
| XLogP | 2.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3E)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3E)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] but-3-enoate?
The IUPAC name of [(3E)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] but-3-enoate (CID 155054936) is [(3E)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] but-3-enoate.
What is the SMILES notation for [(3E)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] but-3-enoate?
The canonical SMILES for [(3E)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] but-3-enoate is C=CCC(=O)OCC/C=C1/OC(=O)OC1(C)C.
What is the InChIKey of [(3E)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] but-3-enoate?
The InChIKey is AIONFKHLCDQKPF-VQHVLOKHSA-N. The full InChI is InChI=1S/C12H16O5/c1-4-6-10(13)15-8-5-7-9-12(2,3)17-11(14)16-9/h4,7H,1,5-6,8H2,2-3H3/b9-7+.
What are the key properties of [(3E)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] but-3-enoate?
[(3E)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] but-3-enoate has a molecular weight of 240.25 g/mol, XLogP of 2.33, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] but-3-enoate is sourced from PubChem (CID 155054936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).