About (4Z)-4-ethenyl-N,7-dimethylocta-4,6-dienimidoyl chloride
(4Z)-4-ethenyl-N,7-dimethylocta-4,6-dienimidoyl chloride (PubChem CID 155055357) has the molecular formula C12H18ClN
and a molecular weight of 211.74 g/mol. Its IUPAC name is (4Z)-4-ethenyl-N,7-dimethylocta-4,6-dienimidoyl chloride.
Molecular Properties
| Compound Name | (4Z)-4-ethenyl-N,7-dimethylocta-4,6-dienimidoyl chloride |
| PubChem CID | 155055357 |
| Molecular Formula | C12H18ClN |
| Molecular Weight | 211.74 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | (4Z)-4-ethenyl-N,7-dimethylocta-4,6-dienimidoyl chloride |
| SMILES | C=C/C(=C\C=C(C)C)CC/C(Cl)=N/C |
| InChI | InChI=1S/C12H18ClN/c1-5-11(7-6-10(2)3)8-9-12(13)14-4/h5-7H,1,8-9H2,2-4H3/b11-7+,14-12- |
| InChIKey | ICUKEZBBZRMWLF-HYIMWACQSA-N |
| XLogP | 4.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.74 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-ethenyl-N,7-dimethylocta-4,6-dienimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-ethenyl-N,7-dimethylocta-4,6-dienimidoyl chloride?
The IUPAC name of (4Z)-4-ethenyl-N,7-dimethylocta-4,6-dienimidoyl chloride (CID 155055357) is (4Z)-4-ethenyl-N,7-dimethylocta-4,6-dienimidoyl chloride.
What is the SMILES notation for (4Z)-4-ethenyl-N,7-dimethylocta-4,6-dienimidoyl chloride?
The canonical SMILES for (4Z)-4-ethenyl-N,7-dimethylocta-4,6-dienimidoyl chloride is C=C/C(=C\C=C(C)C)CC/C(Cl)=N/C.
What is the InChIKey of (4Z)-4-ethenyl-N,7-dimethylocta-4,6-dienimidoyl chloride?
The InChIKey is ICUKEZBBZRMWLF-HYIMWACQSA-N. The full InChI is InChI=1S/C12H18ClN/c1-5-11(7-6-10(2)3)8-9-12(13)14-4/h5-7H,1,8-9H2,2-4H3/b11-7+,14-12-.
What are the key properties of (4Z)-4-ethenyl-N,7-dimethylocta-4,6-dienimidoyl chloride?
(4Z)-4-ethenyl-N,7-dimethylocta-4,6-dienimidoyl chloride has a molecular weight of 211.74 g/mol, XLogP of 4.11, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-ethenyl-N,7-dimethylocta-4,6-dienimidoyl chloride is sourced from PubChem (CID 155055357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).