C12H21NO — CID 155055494
(E,1S,4R)-3-ethyl-N-methoxy-1,3-dimethylbicyclo[2.2.1]heptan-2-imine (PubChem CID 155055494) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (E,1S,4R)-3-ethyl-N-methoxy-1,3-dimethylbicyclo[2.2.1]heptan-2-imine.
| Compound Name | (E,1S,4R)-3-ethyl-N-methoxy-1,3-dimethylbicyclo[2.2.1]heptan-2-imine |
|---|---|
| PubChem CID | 155055494 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (E,1S,4R)-3-ethyl-N-methoxy-1,3-dimethylbicyclo[2.2.1]heptan-2-imine |
| SMILES | CCC1(C)/C(=N/OC)[C@@]2(C)CC[C@@H]1C2 |
| InChI | InChI=1S/C12H21NO/c1-5-12(3)9-6-7-11(2,8-9)10(12)13-14-4/h9H,5-8H2,1-4H3/b13-10+/t9-,11+,12?/m1/s1 |
| InChIKey | VGJVZYUUYVELHG-CNWCBEICSA-N |
| XLogP | 3.23 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|