About 3-iodo-2,2-dimethyl-1-phenylpropan-1-imine
3-iodo-2,2-dimethyl-1-phenylpropan-1-imine (PubChem CID 155055549) has the molecular formula C11H14IN
and a molecular weight of 287.14 g/mol. Its IUPAC name is 3-iodo-2,2-dimethyl-1-phenylpropan-1-imine.
Molecular Properties
| Compound Name | 3-iodo-2,2-dimethyl-1-phenylpropan-1-imine |
| PubChem CID | 155055549 |
| Molecular Formula | C11H14IN |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 3-iodo-2,2-dimethyl-1-phenylpropan-1-imine |
| SMILES | [H]/N=C(\c1ccccc1)C(C)(C)CI |
| InChI | InChI=1S/C11H14IN/c1-11(2,8-12)10(13)9-6-4-3-5-7-9/h3-7,13H,8H2,1-2H3/b13-10+ |
| InChIKey | HLMQHRIUJIGIEZ-JLHYYAGUSA-N |
| XLogP | 3.52 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-2,2-dimethyl-1-phenylpropan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-2,2-dimethyl-1-phenylpropan-1-imine?
The IUPAC name of 3-iodo-2,2-dimethyl-1-phenylpropan-1-imine (CID 155055549) is 3-iodo-2,2-dimethyl-1-phenylpropan-1-imine.
What is the SMILES notation for 3-iodo-2,2-dimethyl-1-phenylpropan-1-imine?
The canonical SMILES for 3-iodo-2,2-dimethyl-1-phenylpropan-1-imine is [H]/N=C(\c1ccccc1)C(C)(C)CI.
What is the InChIKey of 3-iodo-2,2-dimethyl-1-phenylpropan-1-imine?
The InChIKey is HLMQHRIUJIGIEZ-JLHYYAGUSA-N. The full InChI is InChI=1S/C11H14IN/c1-11(2,8-12)10(13)9-6-4-3-5-7-9/h3-7,13H,8H2,1-2H3/b13-10+.
What are the key properties of 3-iodo-2,2-dimethyl-1-phenylpropan-1-imine?
3-iodo-2,2-dimethyl-1-phenylpropan-1-imine has a molecular weight of 287.14 g/mol, XLogP of 3.52, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-2,2-dimethyl-1-phenylpropan-1-imine is sourced from PubChem (CID 155055549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).