C33H28F6N2S2 — CID 15505562
1-[4-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-[[(1R)-1-phenylethyl]iminomethyl]thiophen-3-yl]cyclopenten-1-yl]-5-methylthiophen-2-yl]-N-[(1R)-1-phenylethyl]methanimine (PubChem CID 15505562) has the molecular formula C33H28F6N2S2 and a molecular weight of 630.72 g/mol. Its IUPAC name is 1-[4-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-[[(1R)-1-phenylethyl]iminomethyl]thiophen-3-yl]cyclopenten-1-yl]-5-methylthiophen-2-yl]-N-[(1R)-1-phenylethyl]methanimine.
| Compound Name | 1-[4-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-[[(1R)-1-phenylethyl]iminomethyl]thiophen-3-yl]cyclopenten-1-yl]-5-methylthiophen-2-yl]-N-[(1R)-1-phenylethyl]methanimine |
|---|---|
| PubChem CID | 15505562 |
| Molecular Formula | C33H28F6N2S2 |
| Molecular Weight | 630.72 g/mol |
| Exact Mass | 630.16 |
| IUPAC Name | 1-[4-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-[[(1R)-1-phenylethyl]iminomethyl]thiophen-3-yl]cyclopenten-1-yl]-5-methylthiophen-2-yl]-N-[(1R)-1-phenylethyl]methanimine |
| SMILES | Cc1sc(/C=N/[C@H](C)c2ccccc2)cc1C1=C(c2cc(/C=N/[C@H](C)c3ccccc3)sc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C33H28F6N2S2/c1-19(23-11-7-5-8-12-23)40-17-25-15-27(21(3)42-25)29-30(32(36,37)33(38,39)31(29,34)35)28-16-26(43-22(28)4)18-41-20(2)24-13-9-6-10-14-24/h5-20H,1-4H3/b40-17+,41-18+/t19-,20-/m1/s1 |
| InChIKey | ZHBUGJJDASBGDS-UKDLYMCXSA-N |
| XLogP | 10.62 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.72 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|