C10H10FNO4 — CID 155055621
3-(carboxyamino)-2-(4-fluorophenyl)propanoic acid (PubChem CID 155055621) has the molecular formula C10H10FNO4 and a molecular weight of 227.19 g/mol. Its IUPAC name is 3-(carboxyamino)-2-(4-fluorophenyl)propanoic acid.
| Compound Name | 3-(carboxyamino)-2-(4-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 155055621 |
| Molecular Formula | C10H10FNO4 |
| Molecular Weight | 227.19 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 3-(carboxyamino)-2-(4-fluorophenyl)propanoic acid |
| SMILES | O=C(O)NCC(C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H10FNO4/c11-7-3-1-6(2-4-7)8(9(13)14)5-12-10(15)16/h1-4,8,12H,5H2,(H,13,14)(H,15,16) |
| InChIKey | WSDAMHBDHVLUTG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.19 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |