About (E)-N-[(E)-1-cycloheptylethylideneamino]-3,3-dimethylheptan-2-imine
(E)-N-[(E)-1-cycloheptylethylideneamino]-3,3-dimethylheptan-2-imine (PubChem CID 155055950) has the molecular formula C18H34N2
and a molecular weight of 278.48 g/mol. Its IUPAC name is (E)-N-[(E)-1-cycloheptylethylideneamino]-3,3-dimethylheptan-2-imine.
Molecular Properties
| Compound Name | (E)-N-[(E)-1-cycloheptylethylideneamino]-3,3-dimethylheptan-2-imine |
| PubChem CID | 155055950 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | (E)-N-[(E)-1-cycloheptylethylideneamino]-3,3-dimethylheptan-2-imine |
| SMILES | CCCCC(C)(C)/C(C)=N/N=C(\C)C1CCCCCC1 |
| InChI | InChI=1S/C18H34N2/c1-6-7-14-18(4,5)16(3)20-19-15(2)17-12-10-8-9-11-13-17/h17H,6-14H2,1-5H3/b19-15+,20-16+ |
| InChIKey | UXBYEZACRZKUMO-MXWIWYRXSA-N |
| XLogP | 6.01 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[(E)-1-cycloheptylethylideneamino]-3,3-dimethylheptan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[(E)-1-cycloheptylethylideneamino]-3,3-dimethylheptan-2-imine?
The IUPAC name of (E)-N-[(E)-1-cycloheptylethylideneamino]-3,3-dimethylheptan-2-imine (CID 155055950) is (E)-N-[(E)-1-cycloheptylethylideneamino]-3,3-dimethylheptan-2-imine.
What is the SMILES notation for (E)-N-[(E)-1-cycloheptylethylideneamino]-3,3-dimethylheptan-2-imine?
The canonical SMILES for (E)-N-[(E)-1-cycloheptylethylideneamino]-3,3-dimethylheptan-2-imine is CCCCC(C)(C)/C(C)=N/N=C(\C)C1CCCCCC1.
What is the InChIKey of (E)-N-[(E)-1-cycloheptylethylideneamino]-3,3-dimethylheptan-2-imine?
The InChIKey is UXBYEZACRZKUMO-MXWIWYRXSA-N. The full InChI is InChI=1S/C18H34N2/c1-6-7-14-18(4,5)16(3)20-19-15(2)17-12-10-8-9-11-13-17/h17H,6-14H2,1-5H3/b19-15+,20-16+.
What are the key properties of (E)-N-[(E)-1-cycloheptylethylideneamino]-3,3-dimethylheptan-2-imine?
(E)-N-[(E)-1-cycloheptylethylideneamino]-3,3-dimethylheptan-2-imine has a molecular weight of 278.48 g/mol, XLogP of 6.01, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[(E)-1-cycloheptylethylideneamino]-3,3-dimethylheptan-2-imine is sourced from PubChem (CID 155055950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).