C17H25N3O — CID 155056258
(Z)-N,N,2-trimethyl-4-[(5E,7Z)-2-methyl-9-methylidene-1,4-dihydro-1,3-diazonin-6-yl]pent-2-enamide (PubChem CID 155056258) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is (Z)-N,N,2-trimethyl-4-[(5E,7Z)-2-methyl-9-methylidene-1,4-dihydro-1,3-diazonin-6-yl]pent-2-enamide.
| Compound Name | (Z)-N,N,2-trimethyl-4-[(5E,7Z)-2-methyl-9-methylidene-1,4-dihydro-1,3-diazonin-6-yl]pent-2-enamide |
|---|---|
| PubChem CID | 155056258 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | (Z)-N,N,2-trimethyl-4-[(5E,7Z)-2-methyl-9-methylidene-1,4-dihydro-1,3-diazonin-6-yl]pent-2-enamide |
| SMILES | C=C1/C=C\C(C(C)/C=C(/C)C(=O)N(C)C)=C/C/N=C(/C)N1 |
| InChI | InChI=1S/C17H25N3O/c1-12(11-13(2)17(21)20(5)6)16-8-7-14(3)19-15(4)18-10-9-16/h7-9,11-12H,3,10H2,1-2,4-6H3,(H,18,19)/b8-7-,13-11-,16-9+ |
| InChIKey | DCLTUDNQQNXDGQ-AXVNGCBNSA-N |
| XLogP | 2.67 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|