C22H26FN5O4 — CID 155056369
N-ethyl-N-[(Z)-N-[[7-fluoro-2-(2-methoxy-4-methyl-3-pyridinyl)-1-oxo-3,4-dihydroisoquinolin-6-yl]-methylamino]-C-(hydroxymethyl)carbonimidoyl]formamide (PubChem CID 155056369) has the molecular formula C22H26FN5O4 and a molecular weight of 443.48 g/mol. Its IUPAC name is N-ethyl-N-[(Z)-N-[[7-fluoro-2-(2-methoxy-4-methyl-3-pyridinyl)-1-oxo-3,4-dihydroisoquinolin-6-yl]-methylamino]-C-(hydroxymethyl)carbonimidoyl]formamide.
| Compound Name | N-ethyl-N-[(Z)-N-[[7-fluoro-2-(2-methoxy-4-methyl-3-pyridinyl)-1-oxo-3,4-dihydroisoquinolin-6-yl]-methylamino]-C-(hydroxymethyl)carbonimidoyl]formamide |
|---|---|
| PubChem CID | 155056369 |
| Molecular Formula | C22H26FN5O4 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | N-ethyl-N-[(Z)-N-[[7-fluoro-2-(2-methoxy-4-methyl-3-pyridinyl)-1-oxo-3,4-dihydroisoquinolin-6-yl]-methylamino]-C-(hydroxymethyl)carbonimidoyl]formamide |
| SMILES | CCN(C=O)/C(CO)=N\N(C)c1cc2c(cc1F)C(=O)N(c1c(C)ccnc1OC)CC2 |
| InChI | InChI=1S/C22H26FN5O4/c1-5-27(13-30)19(12-29)25-26(3)18-10-15-7-9-28(22(31)16(15)11-17(18)23)20-14(2)6-8-24-21(20)32-4/h6,8,10-11,13,29H,5,7,9,12H2,1-4H3/b25-19- |
| InChIKey | TYFZDDUQDVUQQM-PLRJNAJWSA-N |
| XLogP | 1.96 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|